| Identification | |
| Name: | Acetamide,N-(acetyloxy)-N-2-phenanthrenyl- |
| Synonyms: | Hydroxylamine,N,O-diacetyl-N-2-phenanthryl- (8CI); N-Acetoxy-2-acetamidophenanthrene;N-Acetoxy-2-acetylaminophenanthrene; N-Acetoxy-N-2-acetylaminophenanthrene |
| CAS: | 26541-57-1 |
| Molecular Formula: | C18H15 N O3 |
| Molecular Weight: | 293.34 |
| InChI: | InChI=1/C18H15NO3/c1-12(20)19(22-13(2)21)16-9-10-18-15(11-16)8-7-14-5-3-4-6-17(14)18/h3-11H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 235.2°C |
| Boiling Point: | 465.3°Cat760mmHg |
| Density: | 1.279g/cm3 |
| Refractive index: | 1.686 |
| Specification: |
N-Acetoxy-2-acetamidophenanthrene (CAS NO.26541-57-1) is also named as Acetic acid, ester with N-(2-phenanthryl)acetohydroxamic acid ; Acetohydroxamic acid, N-(2-phenanthryl)-, acetate ; BRN 2755745 ; Hydroxylamine, N,O-diacetyl-N-(2-phenanthryl)- ; N-(2-Phenanthryl)acetohydroxamic acetate ; N-(Acetyloxy)-N-2-phenanthrenylacetamide ; N-Acetoxy-2-acetylaminophenanthrene ; N-Acetoxy-4-phenanthrylacetamide ; Acetamide, N-(acetyloxy)-N-2-phenanthrenyl- (9CI) ; Acetic acid, (N-acetyl-N-(2-phenanthryl)amino) ester . N-Acetoxy-2-acetamidophenanthrene (CAS NO.26541-57-1) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 235.2°C |
| Safety Data | |
 |
|
