| Identification | |
| Name: | Carbonothioic acid,anhydrosulfide with thiohypochlorous acid (1:1), methyl ester |
| Synonyms: | Carbonicacid, thio-, anhydrosulfide with thiohypochlorous acid, methyl ester (8CI);Carbonothioic acid, anhydrosulfide with thiohypochlorous acid, O-methyl ester(9CI); Thiohypochlorous acid, anhydrosulfide with O-methyl thiocarbonate (8CI);(Chlorothio)(methoxy)oxomethane; Carbomethoxysulfenyl chloride;Methoxycarbonylsulfenyl chloride; Methyl (chlorosulfenyl)formate |
| CAS: | 26555-40-8 |
| EINECS: | 247-801-3 |
| Molecular Formula: | C2H3 Cl O2 S |
| Molecular Weight: | 126.563 |
| InChI: | InChI=1S/C2H3ClO2S/c1-5-2(4)6-3/h1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 8/PG 2 |
| Flash Point: | 34.5°C |
| Boiling Point: | 133.5°Cat760mmHg |
| Density: | 1.4g/cm3 |
| Refractive index: | n20/D 1.481(lit.) |
| Packinggroup: | II |
| Flash Point: | 34.5°C |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
