Pyrrolidine,1-[2-(4-nitrophenoxy)ethyl]- (265654-77-1)

The 1-(2-(4-Nitrophenoxy)ethyl)pyrrolidine with its cas register number is 265654-77-1. It also can be called as Pyrrolidine,1-[2-(4-nitrophenoxy)ethyl]- and the Systematic name about this chemical is 1-[2-(4-nitrophenoxy)ethyl]pyrrolidine. It belongs to the following product categories, such as Amines, blocks, NitroCompounds and so on.

Physical properties about 1-(2-(4-Nitrophenoxy)ethyl)pyrrolidine are: (1)ACD/LogP: 2.47 (2)#H bond acceptors: 5 (3)#Freely Rotating Bonds: 5 (4)Polar Surface Area: 58.29Ų (5)Index of Refraction: 1.562 (6)Molar Refractivity: 64.13 cm³ (7)Molar Volume: 197.5 cm³ (8)Polarizability: 25.42x10^-24cm³ (9)Surface Tension: 47.3 dyne/cm; (10)Enthalpy of Vaporization: 62.73 kJ/mol (11)Vapour Pressure: 5.93E-06 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: [O-][N+](=O)c2ccc(OCCN1CCCC1)cc2
(2)InChI: InChI=1/C12H16N2O3/c15-14(16)11-3-5-12(6-4-11)17-10-9-13-7-1-2-8-13/h3-6H,1-2,7-10H2
(3)InChIKey: RZIYRKYHMDDHCK-UHFFFAOYAM
(4)Std. InChI: InChI=1S/C12H16N2O3/c15-14(16)11-3-5-12(6-4-11)17-10-9-13-7-1-2-8-13/h3-6H,1-2,7-10H2
(5)Std. InChIKey: RZIYRKYHMDDHCK-UHFFFAOYSA-N