| Identification | |
| Name: | 2-Propen-1-one,1-(4-hydroxyphenyl)-3-phenyl- |
| Synonyms: | Chalcone,4'-hydroxy- (6CI,7CI,8CI); 1-(4-Hydroxyphenyl)-3-phenyl-2-propen-1-one;1-(4-Hydroxyphenyl)-3-phenylpropenone; 4-Hydroxyphenyl styryl ketone;4'-Hydroxychalcone; NSC 242264; p-Cinnamoylphenol |
| CAS: | 2657-25-2 |
| Molecular Formula: | C15H12 O2 |
| Molecular Weight: | 224.25458 |
| InChI: | InChI=1S/C15H12O2/c16-14-9-7-13(8-10-14)15(17)11-6-12-4-2-1-3-5-12/h1-11,16H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.191 g/cm3 |
| Refractive index: | 1.653 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | yellow-cream powder |
| Specification: | yellow-cream powder Safety Statements:37/39-26 37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
