| Identification | |
| Name: | Acetamide,N-(acetyloxy)-N-[4-(2-phenylethenyl)phenyl]- |
| Synonyms: | Hydroxylamine,N,O-diacetyl-N-(p-styrylphenyl)- (7CI,8CI); N-Acetoxy-4-acetamidostilbene;N-Acetoxy-4-acetylaminostilbene; N-Acetoxy-N-(4-stilbenyl)acetamide |
| CAS: | 26594-44-5 |
| Molecular Formula: | C18H17 N O3 |
| Molecular Weight: | 295.36 |
| InChI: | InChI=1/C18H17NO3/c1-14(20)19(22-15(2)21)18-12-10-17(11-13-18)9-8-16-6-4-3-5-7-16/h3-13H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 218.7°C |
| Boiling Point: | 438°Cat760mmHg |
| Density: | 1.209g/cm3 |
| Refractive index: | 1.649 |
| Specification: |
N-Acetoxy-N-(4-stilbenyl)-acetamide (CAS NO.26594-44-5) is also named as Acetic acid, (N-acetyl-N-(p-styrylphenyl)amino) ester ; Acetic acid, ester with N-(p-styrylphenyl)acetohydroxamic acid ; Acetohydroxamic acid, N-(p-styrylphenyl)-, acetate ; BRN 2751068 ; CCRIS 730 ; N,O-Diacetyl-N-(p-styrylphenyl)hydroxylamine ; N-(Acetyloxy)-N-(4-(2-phenylethenyl)phenyl)acetamide ; N-(p-Styrylphenyl)acetohydroxamic acetate ; N-(p-Styrylphenyl)acetohydroxamic acid acetate ; N-Acetoxy-4-acetamidostilbene ; N-Acetoxy-4-acetylaminostilbene . N-Acetoxy-N-(4-stilbenyl)-acetamide (CAS NO.26594-44-5) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 218.7°C |
| Safety Data | |
 |
|
