| Identification | |
| Name: | Pentanamide,4-methyl-3-oxo-N-(phenyl-d5)-2-(phenylmethylene)- (9CI) |
| CAS: | 265989-32-0 |
| Molecular Formula: | C19H14 D5 N O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C19H19NO2/c1-14(2)18(21)17(13-15-9-5-3-6-10-15)19(22)20-16-11-7-4-8-12-16/h3-14H,1-2H3,(H,20,22)/b17-13+/i3D,5D,6D,9D,10D |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 188.668°C |
| Boiling Point: | 519.438°C at 760 mmHg |
| Density: | 1.172g/cm3 |
| Refractive index: | 1.622 |
| Flash Point: | 188.668°C |
| Usage: | An deuterated intermediate of deuterated Atorvastatin, a selective, competitive HMG-CoA reductase inhibitor. The only drug in its class specfically indicated for lowering both elevated LDL-cholesterol and triglycerides in patients with hypercholest |
| Safety Data | |
 |
|
