| Identification | |
| Name: | Ropaque OP 42 |
| Synonyms: | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with ethenylbenzene and methyl 2-methyl-2-propenoate;2-METHYL-2-PROPENOIC ACID BUTYL ESTER POLYMER WITH ETHENYLBENZENE AND METHYL 2-METHYL-2-PROPENOATE;styrene/ butyl methacrylate / methyl methacrylate polymer |
| CAS: | 26634-89-9 |
| Molecular Formula: | C21H30O4 |
| Molecular Weight: | 346.4605 |
| InChI: | InChI=1S/C8H14O2.C8H8.C5H8O2/c1-4-5-6-10-8(9)7(2)3;1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3/h2,4-6H2,1,3H3;2-7H,1H2;1H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 50.6°C |
| Boiling Point: | 160°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 50.6°C |
| Safety Data | |
 |
|
