Identification |
Name: | Boric acid,tris(2-methylphenyl) ester |
Synonyms: | Boric acid(H3BO3), tri-o-tolyl ester (8CI); Boric acid (H3BO3), tris(2-methylphenyl)ester (9CI); o-Tolyl borate (6CI,7CI); NSC 807; Tri-o-cresyl borate;Tri-o-tolyl borate; Tris(o-methylphenyl) borate |
CAS: | 2665-12-5 |
EINECS: | 247-538-4 |
Molecular Formula: | C21H21 B O3 |
Molecular Weight: | 380.23 |
InChI: | InChI=1/C21H21BO3/c1-16-10-4-7-13-19(16)23-22(24-20-14-8-5-11-17(20)2)25-21-15-9-6-12-18(21)3/h4-15H,1-3H3 |
Molecular Structure: |
|
Properties |
Density: | 1.091 g/cm3 |
Specification: |
Tri-o-cresyl borate , its cas register number is 2665-12-5. It also can be called Boric acid (H3BO3), tri-o-tolyl ester (8CI) ; and Boric acid, tri-o-cresyl ester .
|
Safety Data |
|
|