| Identification | |
| Name: | 1,3,2-Dioxaborinane,2,2'-[(1-methyl-1,3-propanediyl)bis(oxy)]bis[4-methyl- |
| Synonyms: | 1,3-Butanediol,cyclic diester with 1-methyltrimethylene borate (7CI); 1,3-Butanediol, cyclicester with boric acid (H3BO3), 1-methyltrimethylene ester (8CI);2,2'-(1-Methyltrimethylenedioxy)bis[4-methyl-1,3,2-dioxaborinane]; Borester 36;NSC 526740; Tri(butylene glycol) biborate |
| CAS: | 2665-13-6 |
| EINECS: | 220-198-4 |
| Molecular Formula: | C12H24 B2 O6 |
| Molecular Weight: | 285.9374 |
| InChI: | InChI=1/C12H24B2O6/c1-10-4-7-15-13(18-10)16-8-5-11(2)19-14-17-9-6-12(3)20-14/h10-12H,4-9H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 122.8°C |
| Boiling Point: | 279.5°Cat760mmHg |
| Density: | 1.05g/cm3 |
| Refractive index: | 1.433 |
| Flash Point: | 122.8°C |
| Safety Data | |
 |
|
