Identification |
Name: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 2-propenyl 2-methyl-2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 2-propenyl 2-methyl-2-propenoate |
CAS: | 26715-19-5 |
Molecular Formula: | C12H18O4 |
Molecular Weight: | 0 |
InChI: | InChI=1/C7H10O2.C5H8O2/c1-4-5-9-7(8)6(2)3;1-4(2)5(6)7-3/h4H,1-2,5H2,3H3;1H2,2-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 33.9°C |
Boiling Point: | 138.6°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 33.9°C |
Safety Data |
|
 |