Identification |
Name: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with butyl 2-propenoate and 2-methyl-2-propenamide |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with butyl 2-propenoate and 2-methyl-2-propenamide |
CAS: | 26715-67-3 |
Molecular Formula: | C16H27NO5 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C7H12O2.C5H8O2.C4H7NO/c1-3-5-6-9-7(8)4-2;1-4(2)5(6)7-3;1-3(2)4(5)6/h4H,2-3,5-6H2,1H3;1H2,2-3H3;1H2,2H3,(H2,5,6) |
Molecular Structure: |
 |
Properties |
Flash Point: | 39.4°C |
Boiling Point: | 145.9°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 39.4°C |
Safety Data |
|
 |