| Identification | |
| Name: | Butene, 2-methyl- |
| Synonyms: | Isoamylene(6CI,7CI);2-Methylbutene;Isopentene;Methylbutene;tert-Amylene; |
| CAS: | 26760-64-5 |
| EINECS: | 247-975-0 |
| Molecular Formula: | C5 H12 |
| Molecular Weight: | 70.15 |
| InChI: | InChI=1/C5H10/c1-4-5(2)3/h2,4H2,1,3H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -137.5 deg C |
| Boiling Point: | 30.4°C at 760 mmHg |
| Density: | 0.661g/cm3 |
| Refractive index: | 1.384 |
| Solubility: | Sol in alcohol, ether, benzene In water, 130 mg/l @ 20 deg C. |
| Specification: |
2-Methylbutene (CAS NO.26760-64-5) is flammable liquids. It can burst by heat and fire. 2-Methylbutene (CAS NO.26760-64-5) can form an explosive mixture if mixed with air. So the storage environment should be ventilate, low-temperature and dry. Keep 2-Methylbutene (CAS NO.26760-64-5) separate from Oxidants, acids |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
