| Identification | |
| Name: | Hydroperoxide,bis(1-methylethyl)phenyl |
| Synonyms: | Hydroperoxide,diisopropylphenyl (7CI,8CI); Bis(1-methylethyl)phenyl hydroperoxide;Diisopropylphenyl hydroperoxide |
| CAS: | 26762-93-6 |
| EINECS: | 247-988-1 |
| Molecular Formula: | C12H18 O2 |
| Molecular Weight: | 194.27 |
| InChI: | InChI=1/C12H18.H2O2/c1-9(2)11-7-5-6-8-12(11)10(3)4;1-2/h5-10H,1-4H3;1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2171 |
| Melting Point: | <-9 |
| Density: | 0.935~9.60g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.4880~1.510 |
| Appearance: | Liquid; colorless to pale yellow; sharp, unpleasant odor. |
| Packinggroup: | II |
| Storage Temperature: | Materials which are toxic as stored or which can decompose into toxic components.Should be stored in a cool, well ventilated place, out of the direct rays of the sun, away from areas of high fire hazard, and should be periodically inspected. Incompatible materials should be isolated. |
| Usage: | Chemical intermediate for hydroquinone (para-isomer). |
| Safety Data | |
 |
|
