| Identification | |
| Name: | 1,4-Cyclohexadiene-1-aceticacid, a-amino-, (aR)- |
| CAS: | 26774-88-9 |
| EINECS: | 247-999-1 |
| Molecular Formula: | C8H11NO2 |
| Molecular Weight: | 153.18 |
| InChI: | InChI=1/C8H11NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-2,5,7H,3-4,9H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.226 g/cm3 |
| Refractive index: | -155 ° (C=1, 1mol/L HCl) |
| Alpha: | -154 º (C=1 IN H2O) |
| Solubility: | Appearance:White to off-white crystalline powder Transport Information:HAZARD Hazard Symbols:UN NO. Safety:24/25 |
| Appearance: | White to off-white crystalline powder |
| Storage Temperature: | -20°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
