| Identification | |
| Name: | Ethene, 1,1-diethoxy- |
| Synonyms: | ketene diethyl acetal |
| CAS: | 2678-54-8 |
| Molecular Formula: | C6H12 O2 |
| Molecular Weight: | 116.16 |
| InChI: | InChI=1/C6H12O2/c1-4-7-6(3)8-5-2/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Flash Point: | 7°C |
| Boiling Point: | 105.6°Cat760mmHg |
| Density: | 0.859g/cm3 |
| Refractive index: | n20/D 1.414 |
| Specification: | Safety Statements:23 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) |
| Flash Point: | 7°C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
