Identification |
Name: | 2-Propenoic acid,2-methyl-,esters,methyl ester,polymer with ethenyl acetate and 2-ethylhexyl 2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with ethenyl acetate and 2-ethylhexyl 2-propenoate;METHYL 2-METHYL-2-PROPENOATE, POLYMER WITH ETHENYL ACETATE AND 2-ETHYLHEXYL 2-PROPENOATE;methyl methacrylate/ 2-ethylhexyl acrylate/ vinyl acetate |
CAS: | 26794-25-2 |
Molecular Formula: | C20H34O6 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C11H20O2.C5H8O2.C4H6O2/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-4(2)5(6)7-3;1-3-6-4(2)5/h6,10H,3-5,7-9H2,1-2H3;1H2,2-3H3;3H,1H2,2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 79.4°C |
Boiling Point: | 216°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 79.4°C |
Safety Data |
|
|