Identification |
Name: | 2-Propenoic acid, butyl ester, polymer with 2-propenamide and 2-propenenitrile |
Synonyms: | 2-Propenoic acid, butyl ester, polymer with 2-propenamide and 2-propenenitrile Butyl acrylate, acrylonitrile, acrylamide polymer 2-propenoic acid, butyl ester, polymer with2-propenamide and 2-propenenitrile;2-Propenoic acid, butyl ester, polymer with 2-propenamide and 2-propenenitrile |
CAS: | 26794-58-1 |
Molecular Formula: | C13H20N2O3 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C7H12O2.C3H5NO.C3H3N/c1-3-5-6-9-7(8)4-2;1-2-3(4)5;1-2-3-4/h4H,2-3,5-6H2,1H3;2H,1H2,(H2,4,5);2H,1H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 39.4°C |
Boiling Point: | 145.9°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 39.4°C |
Safety Data |
|
 |