| Identification |
| Name: | HVWT 54 |
| Synonyms: | DMHF;Formaldehyde, polymer with 5,5-dimethyl-2,4-imidazolidinedione;formaldehyde/ 5,5-dimethylhydantoin copolymer;5,5-Dimethylhydantoin Formaldehyde Resin;5,5-Dimethylimidazolidine-2,4-dione/Formaldehyd-Polymer (75% in Water);Dantoin(R) 739 |
| CAS: | 26811-08-5 |
| EINECS: | 500-052-9 |
| Molecular Formula: | C6H10N2O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C5H8N2O2.CH2O/c1-5(2)3(8)6-4(9)7-5;1-2/h1-2H3,(H2,6,7,8,9);1H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 106.6°C |
| Boiling Point: | 244.1°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 106.6°C |
| Usage: | Dantoin(R) 739 is a formaldehyde resin based on dimethyl hydantoin. This product has found use in cosmetic formulation, adhesive, coatings and inks, photographic films, textiles, glass fiber as a film former and as a binder. |
| Safety Data |
| |
 |
