Identification |
Name: | Benzenamine,2,4-dichloro-6-nitro- |
Synonyms: | Aniline,2,4-dichloro-6-nitro- (6CI,7CI,8CI); 1-Nitro-2-amine-3,5-dichlorobenzene;2,4-Dichloro-6-nitroaniline; 2-Nitro-4,6-dichloroaniline;4,6-Dichloro-2-nitroaniline; NSC 28582 |
CAS: | 2683-43-4 |
EINECS: | 220-241-7 |
Molecular Formula: | C6H4 Cl2 N2 O2 |
Molecular Weight: | 207.01 |
InChI: | InChI=1/C6H4Cl2N2O2/c7-3-1-4(8)6(9)5(2-3)10(11)12/h1-2H,9H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2811 6.1/PG 3 |
Flash Point: | 139.8°C |
Boiling Point: | 307.5°C at 760 mmHg |
Density: | 1.624g/cm3 |
Refractive index: | 1.655 |
Specification: | YELLOW FLUFFY POWDER Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Packinggroup: | III |
Flash Point: | 139.8°C |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |