| Identification | |
| Name: | 4-Methyl-2-nitrobenzonitrile |
| Synonyms: | - |
| CAS: | 26830-95-5 |
| EINECS: | 248-019-5 |
| Molecular Formula: | C8H6N2O2 |
| Molecular Weight: | 162.14544 |
| InChI: | InChI=1S/C8H6N2O2/c1-6-2-3-7(5-9)8(4-6)10(11)12/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Density: | 1.26 g/cm3 |
| Refractive index: | 1.568 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | White Crystalline Solid |
| Specification: |
Avoid breathing dust, vapor, mist, or gas. Avoid contact with skin and eyes.Store in a cool, dry place. Store in a tightly closed container. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
