| Identification | |
| Name: | 3-Thiophenecarboxylicacid, tetrahydro-4-oxo-, methyl ester |
| Synonyms: | 4-Carbomethoxy-2,3,4,5-tetrahydro-3-thiophenone;4-Carbomethoxy-3-thiophanone;4-Oxotetrahydrothiophene-3-carboxylic acid methylester;Methyl 4-oxo-2,3,4,5-tetrahydrothiophene-3-carboxylate;Methyl4-oxotetrahydrothienyl-3-carboxylate;Methyl4-oxotetrahydrothiophene-3-carboxylate;Methyltetrahydro-4-oxo-3-thiophenecarboxylate;NSC 127560;Tetrahydro-4-oxo-3-thiophenecarboxylicacid methyl ester;Methyl 4-oxotetrahydrothiophene-3-carboxylate; |
| CAS: | 2689-68-1 |
| EINECS: | 220-256-9 |
| Molecular Formula: | C6H8 O3 S |
| Molecular Weight: | 160.1909 |
| InChI: | InChI=1/C6H8O3S/c1-9-6(8)4-2-10-3-5(4)7/h4H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 38-41ºC |
| Density: | 1.309 g/cm3 |
| Appearance: | Slight yellow to yellow crystalline powder |
| Specification: |
3-Thiophenecarboxylicacid, tetrahydro-4-oxo-, methyl ester , its cas register number is 2689-68-1. It also can be called 4-Carbomethoxy-3-thiophanone ; EINECS 220-256-9 ; Methyl tetrahydro-4-oxo-3-thiophenecarboxylate ; NSC 127560 . 3-Thiophenecarboxylicacid, tetrahydro-4-oxo-, methyl ester (CAS NO.2689-68-1) is irritating to eyes, respiratory system and skin. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
