| Identification |
| Name: | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with methyl 2-methyl-2-propenoate and 2-propenoic acid |
| Synonyms: | 2-Propenoic acid, 2-methyl-, butyl ester, polymer with methyl 2-methyl-2-propenoate and 2-propenoic acid |
| CAS: | 26898-31-7 |
| Molecular Formula: | C16H26O6 |
| Molecular Weight: | 314.37404 |
| InChI: | InChI=1S/C8H14O2.C5H8O2.C3H4O2/c1-4-5-6-10-8(9)7(2)3;1-4(2)5(6)7-3;1-2-3(4)5/h2,4-6H2,1,3H3;1H2,2-3H3;2H,1H2,(H,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 50.6°C |
| Boiling Point: | 160°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 50.6°C |
| Safety Data |
| |
 |
