| Identification | |
| Name: | 3-Aminofluoranthene |
| Synonyms: | 4-Aminofluoranthene;4-Fluoranthenamine; |
| CAS: | 2693-46-1 |
| EINECS: | 220-263-7 |
| Molecular Formula: | C16H11N |
| Molecular Weight: | 217.2652 |
| InChI: | InChI=1/C16H11N/c17-15-9-8-13-11-5-2-1-4-10(11)12-6-3-7-14(15)16(12)13/h1-9H,17H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3077 |
| Density: | 1.322g/cm3 |
| Refractive index: | 1.904 |
| Specification: |
3-Aminofluoranthene , with CAS number of 2693-46-1, can be called Timtec-bb sbb003376 ; 4-Aminofluoranthene ; 4-Fluoranthenamine ; fluoranthen-3-ylamine ; 3-Aminofluoranthene 95% . It is a yellow-green to brown crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
