| Identification | |
| Name: | formaldehyde; naphthalene-2,7-diol; phenol |
| Synonyms: | L 8 (phenolic resin);formaldehyde; naphthalene-2,7-diol; phenol;1-(beta-Bromophenethyl)piperidine hydrobromide;L 8;Piperidine, 1-(beta-bromophenethyl)-, hydrobromide;AC1L4VFL;AC1Q691H;AR-1J0909;LS-114338;Formaldehyde, polymer with 2,7-naphthalenediol and phenol;Formaldehyde, polymer with 2,7-naphthalenediol and phenol (9CI) |
| CAS: | 26936-19-6 |
| Molecular Formula: | C17H16O4 |
| Molecular Weight: | 284.3065 |
| InChI: | InChI=1/C10H8O2.C6H6O.CH2O/c11-9-3-1-7-2-4-10(12)6-8(7)5-9;7-6-4-2-1-3-5-6;1-2/h1-6,11-12H;1-5,7H;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 193.5°C |
| Boiling Point: | 375.4°C at 760 mmHg |
| Flash Point: | 193.5°C |
| Safety Data | |
 |
|
