| Identification |
| Name: | 2-Propenoic acid,2-methyl-, polymer with methyl 2-methyl-2-propenoate, sodium salt |
| Synonyms: | Methacrylicacid, polymer with methyl methacrylate, sodium salt (8CI); 2-Propenoic acid,2-methyl-, methyl ester, polymer with 2-methyl-2-propenoic acid, sodium salt(9CI); Methacrylic acid methyl ester, polymer with methacrylic acid, sodiumsalt (8CI); Eudispert sodium; Eudispert sodium salt; Lakris 20B; MMK;Methacrylic acid-methyl methacrylate polymer sodium salt; Methacrylicacid-methylmethacrylate copolymer sodium salt; Methyl methacrylate-methacrylicacid copolymer sodium salt |
| CAS: | 26950-79-8 |
| Molecular Formula: | (C5 H8 O2 . C4 H6 O2)x |
| Molecular Weight: | 208.1869 |
| InChI: | InChI=1S/C5H8O2.C4H6O2.Na/c1-4(2)5(6)7-3;1-3(2)4(5)6;/h1H2,2-3H3;1H2,2H3,(H,5,6);/q;;+1/p-1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 10°C |
| Boiling Point: | 100.3°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 10°C |
| Safety Data |
| |
 |
