| Identification | |
| Name: | Benzonitrile,2-amino-4,5-dimethoxy- |
| Synonyms: | Veratronitrile,6-amino- (8CI);2-Amino-4,5-dimethoxybenzonitrile;2-Cyano-4,5-dimethoxyaniline;3,4-Dimethoxy-6-cyanoaniline;4,5-Dimethoxyanthranilonitrile;6-Amino-3,4-dimethoxybenzonitrile;6-Aminoveratronitrile; |
| CAS: | 26961-27-3 |
| Molecular Formula: | C9H10N2O2 |
| Molecular Weight: | 178.19 |
| InChI: | InChI=1/C9H10N2O2/c1-12-8-3-6(5-10)7(11)4-9(8)13-2/h3-4H,11H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Flash Point: | 163.4°C |
| Boiling Point: | 346.6°Cat760mmHg |
| Density: | 1.2g/cm3 |
| Refractive index: | 1.555 |
| Specification: |
The extinguishing agent of 2-Amino-4,5-dimethoxybenzonitrile (CAS No.26961-27-3) are dry powder, foam, sand, carbon dioxide, water mist. |
| Packinggroup: | III |
| Flash Point: | 163.4°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
