| Identification | |
| Name: | 1,3-Benzenediol,homopolymer |
| Synonyms: | Resorcinol,polymers (8CI); Poly(1,3-dihydroxybenzene); Polyresorcinol; Rescorcinolhomopolymer; Resorcinol homopolymer; Resorcinol polymer |
| CAS: | 26982-54-7 |
| EINECS: | 500-056-0 |
| Molecular Formula: | C6 H6 O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 109-111 deg C |
| Flash Point: | 131.9°C |
| Boiling Point: | 280°Cat760mmHg |
| Density: | 1.275g/cm3 |
| Solubility: | 1 g dissolves in 0.9 ml water at room temperature, 0.2 ml water @ 80 deg C, 0.9 ml alcohol; freely sol in ether, glycerol; slightly sol in chloroform Sol in water, alcohol, ether and acetic acid Sol in DMSO at greater than or equal to 100 mg/ml at 18 deg C. Sol in acetone at greater than or equal to 100 mg/ml at 18 deg C. In water, 7.17X10+5 mg/l @ 25 deg C. |
| Flash Point: | 131.9°C |
| Color: | White needle-like crystals NEEDLES FROM BENZENE; PLATES FROM WATER Rhombic tablets and pyramids POWDER White needles, plates, crystals, flakes, or powder [Note: Turns pink on exposure to air or light, or contact with iron]. |
| Safety Data | |
 |
|
