Identification |
Name: | Phenol,thiobis[dodecyl-, calcium salt (1:1) |
Synonyms: | calcium thiobis[dodecylphenolate];Phenol, thiobisdodecyl-, calcium salt (1:1);Calcium salt of thiobis(C12-alkylated phenol);Phenol, thiobis[dodecyl-, calcium salt;thiobis[dodecyl-pheno calcium salt |
CAS: | 26998-97-0 |
EINECS: | 248-159-7 |
Molecular Formula: | C36H58 O2 S . Ca |
Molecular Weight: | 592.97164 |
InChI: | InChI=1/C36H58O2S.Ca/c1-3-5-7-9-11-13-15-17-19-21-25-31-33(37)27-23-29-35(31)39-36-30-24-28-34(38)32(36)26-22-20-18-16-14-12-10-8-6-4-2;/h23-24,27-30,37-38H,3-22,25-26H2,1-2H3;/q;+2/p-2 |
Molecular Structure: |
![(C36H58O2S.Ca) calcium thiobis[dodecylphenolate];Phenol, thiobisdodecyl-, calcium salt (1:1);Calcium salt of thiobi...](https://img1.guidechem.com/chem/e/dict/195/26998-97-0.jpg) |
Properties |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Flash Point: | °C |
Safety Data |
|
 |