Identification |
Name: | 2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, polymer with ethyl 2-propenoate and methyl 2-methyl-2-propenoate |
Synonyms: | 2-Propenoic acid, 2-methyl-, 2-hydroxyethyl ester, polymer with ethyl 2-propenoate and methyl 2-methyl-2-propenoate |
CAS: | 27012-37-9 |
Molecular Formula: | C16H26O7 |
Molecular Weight: | 0 |
InChI: | InChI=1/C6H10O3.2C5H8O2/c1-5(2)6(8)9-4-3-7;1-4(2)5(6)7-3;1-3-4(2)5(6)7/h7H,1,3-4H2,2H3;1H2,2-3H3;2-3H2,1H3,(H,6,7) |
Molecular Structure: |
 |
Properties |
Flash Point: | 97.2°C |
Boiling Point: | 189°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 97.2°C |
Safety Data |
|
 |