| Identification | |
| Name: | D-Glutamic acid,N-[(phenylmethoxy)carbonyl]-, 5-methyl ester |
| Synonyms: | Glutamicacid, N-carboxy-, N-benzyl 5-methyl ester, D- (8CI) |
| CAS: | 27025-24-7 |
| Molecular Formula: | C14H17 N O6 |
| Molecular Weight: | 295.29 |
| InChI: | InChI=1/C14H17NO6/c1-20-12(16)8-7-11(13(17)18)15-14(19)21-9-10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,15,19)(H,17,18)/t11-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 262.6°C |
| Boiling Point: | 510.6°C at 760 mmHg |
| Density: | 1.272g/cm3 |
| Refractive index: | 1.535 |
| Specification: |
The extinguishing agent of Z-D-Glu(ome)-oh (CAS NO.27025-24-7) are dry powder, foam, sand, carbon dioxide, water mist. |
| Flash Point: | 262.6°C |
| Storage Temperature: | -15°C |
| Safety Data | |
 |
|
