| Identification | |
| Name: | PFS 2803 |
| Synonyms: | Formaldehyde, polymer with 3-methylphenol and 4-methylphenol;formaldehyde, polymer with 3-methylphenol and4-methylphenol;Formaldehyde,polymer with 3-methylphenol and 4-methylphenol;m-Cresol, p-cresol, formaldehyde polymer;FORMALDEHYDE-3-METHYLPHENOL-4-METHYLPHENOL POLYMER);m-cresol, p-cresol/ formaldehyde resin |
| CAS: | 27029-76-1 |
| Molecular Formula: | C15H18O3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/2C7H8O.CH2O/c1-6-2-4-7(8)5-3-6;1-6-3-2-4-7(8)5-6;1-2/h2*2-5,8H,1H3;1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 81°C |
| Boiling Point: | 202°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 81°C |
| Safety Data | |
 |
|
