Identification |
Name: | Oxazolo[3,2-d][1,4]benzodiazepin-6(5H)-one,10-chloro-11b-(2-fluorophenyl)-2,3,7,11b-tetrahydro-7-(2-hydroxyethyl)- |
Synonyms: | Oxazolo[3,2-d][1,4]benzodiazepin-6(5H)-one,10-chloro-11b-(o-fluorophenyl)-2,3,7,11b-tetrahydro-7-(2-hydroxyethyl)- (8CI);Coreminal; Flutazolam; MS 4101; Ro 7-6102 |
CAS: | 27060-91-9 |
Molecular Formula: | C19H18 Cl F N2 O3 |
Molecular Weight: | 376.84 |
InChI: | InChI=1/C19H18ClFN2O3/c20-13-5-6-17-15(11-13)19(14-3-1-2-4-16(14)21)22(8-10-26-19)12-18(25)23(17)7-9-24/h1-6,11,24H,7-10,12H2 |
Molecular Structure: |
![(C19H18ClFN2O3) Oxazolo[3,2-d][1,4]benzodiazepin-6(5H)-one,10-chloro-11b-(o-fluorophenyl)-2,3,7,11b-tetrahydro-7-(2-...](https://img1.guidechem.com/chem/e/dict/165/27060-91-9.jpg) |
Properties |
Flash Point: | 317.8°C |
Boiling Point: | 601.9°Cat760mmHg |
Density: | 1.47g/cm3 |
Refractive index: | 1.672 |
Specification: |
Flutazolam (CAS NO.27060-91-9) has sedative, muscle relaxant, anticonvulsant, and anxiolytic effects similar to those produced by other benzodiazepine derivatives, and though it's around the same potency as diazepam, it produces a more marked sedation and impaired coordination
|
Flash Point: | 317.8°C |
Safety Data |
|
 |