| Identification | |
| Name: | Tilidine hydrochloride hemihydrate |
| CAS: | 27107-79-5 |
| EINECS: | 248-226-0 |
| Molecular Formula: | C17H23 N O2 . Cl H |
| Molecular Weight: | 309.87 |
| InChI: | InChI=1/C17H23NO2.ClH/c1-4-20-16(19)17(14-10-6-5-7-11-14)13-9-8-12-15(17)18(2)3;/h5-8,10-12,15H,4,9,13H2,1-3H3;1H/t15-,17+;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 114°C |
| Boiling Point: | 354.2°Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
Ethyl (1S,2R)-2-(dimethylamino)-1-phenylcyclohex-3-ene-1-carboxylate hydrochloride with CAS number of 27107-79-5 is also known as Tilidine hydrochloride hemihydrate ; (+-)-Ethyl-trans-2-(dimethylamino)-1-phenyl-3-cyclohexene-1-carboxylatehydro ; 3-Cyclohexene-1-carboxylicacid,2-(dimethylamino)-1-phenyl-,ethylester,hydr ; Dl-trans,trans-tildinehydrochloride ; Dl-trans-2-dimethylamino-1-phenyl-cyclohex-3-ene-trans-carbonicacidethyles ; Dl-trans-2-dimethylamino-1-phenyl-cyclohex-3-en-trans-1-carbonsaeureaethyles ; Ethyldl-trans-2-dimethylamino-1-phenyl-3-cyclohexene-1-carboxylate ; Go-1261 . |
| Flash Point: | 114°C |
| Safety Data | |
 |
|
