| Identification | |
| Name: | 3,5-Difluorophenol |
| Synonyms: | 3,5-DIFLUOROPHENOL;Phenol,3,5-difluoro-;3,5-Difluorophenol,98+%;3,5-Difluorophenol 99%;3,5-Difluorophenol99% |
| CAS: | 2713-34-0 |
| EINECS: | -0 |
| Molecular Formula: | C6H4F2O |
| Molecular Weight: | 130.09 |
| InChI: | InChI=1/C6H4F2O/c7-4-1-5(8)3-6(9)2-4/h1-3,9H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1325 |
| Density: | 1.351 g/cm3 |
| Refractive index: | 1.589 |
| Appearance: | off-white crystals |
| Specification: | white to beige crystals Safety Statements:26-36-45-36/37/39-16 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 16:Keep away from sources of ignition - No smoking |
| Packinggroup: | III |
| HS Code: | 29081000 |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
