| Identification |
| Name: | Cyclohexanecarboxylic acid chloride |
| Synonyms: | Cyclohexanecarbonyl chloride; Hexahydrobenzoyl chloride; Cyclohexyl Carboxylic Acid Chloride; 7-Ethyl-3-(2-hydroxyethyl)indole; Cyclotexaformyl Chloride |
| CAS: | 2719-27-9 |
| EINECS: | 220-322-7 |
| Molecular Formula: | C7H11ClO |
| Molecular Weight: | 146.62 |
| InChI: | InChI=1/C7H11ClO/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Melting Point: | 29 C |
| Density: | 1.096 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.468-1.47 |
| Water Solubility: | HYDROLYSES |
| Solubility: | hydrolyses |
| Appearance: | clear to yellow liquid |
| Packinggroup: | II |
| HS Code: | 29162000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
