| Identification | |
| Name: | Benzonitrile,4-isothiocyanato- |
| Synonyms: | Isothiocyanicacid, p-cyanophenyl ester (7CI,8CI); 4-Cyanophenyl isothiocyanate;4-Isothiocyanatobenzonitrile; p-Cyanophenyl isothiocyanate |
| CAS: | 2719-32-6 |
| EINECS: | 220-323-2 |
| Molecular Formula: | C8H4 N2 S |
| Molecular Weight: | 160.2 |
| InChI: | InChI=1/C8H4N2S/c9-5-7-1-3-8(4-2-7)10-6-11/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 6.1/PG 3 |
| Melting Point: | 119-123 °C(lit.) |
| Flash Point: | 144.1°C |
| Boiling Point: | 314.7°Cat760mmHg |
| Density: | 1.12g/cm3 |
| Refractive index: | 1.604 |
| Appearance: | light yellow to beige crystalline powder |
| Report: |
Cyanide and its compounds are on the Community Right-To-Know List. Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 144.1°C |
| Storage Temperature: | Keep Cold |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
