| Identification |
| Name: | 4-Azaindole |
| Synonyms: | 5-23-06-00303 (Beilstein Handbook Reference);1H-Pyrrolo[3,2-b]pyridine;5,9-diazabicyclo[4.3.0]nona-2,4,7,10-tetraene;1H-Pyrrolo(3,2-b)pyridine;1,4-Diazaindene; |
| CAS: | 272-49-1 |
| Molecular Formula: | C7H6N2 |
| Molecular Weight: | 118.13594 |
| InChI: | InChI=1S/C7H6N2/c1-2-6-7(8-4-1)3-5-9-6/h1-5,9H |
| Molecular Structure: |
![(C7H6N2) 5-23-06-00303 (Beilstein Handbook Reference);1H-Pyrrolo[3,2-b]pyridine;5,9-diazabicyclo[4.3.0]nona-2...](https://img.guidechem.com/casimg/272-49-1.gif) |
| Properties |
| Melting Point: | 126-127oC |
| Flash Point: | 124.8 oC |
| Boiling Point: | 273.8 oC |
| Density: | 1.242 g/cm3 |
| Refractive index: | 1.697 |
| Water Solubility: | Hardly soluble in water, but soluble in methanol and chloroform |
| Solubility: | Hardly soluble in water, but soluble in methanol and chloroform |
| Appearance: | White to off-white crystalline powder |
| HS Code: | 29339980 |
| Flash Point: | 124.8 oC |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
