| Identification | |
| Name: | Thiourea,N-methyl-N'-phenyl- |
| Synonyms: | Urea,1-methyl-3-phenyl-2-thio- (6CI,7CI,8CI); 1-Methyl-3-phenyl-2-thiourea;1-Methyl-3-phenylthiocarbamide; 1-Methyl-3-phenylthiourea;1-Phenyl-3-methylthiourea; N-Methyl-N'-phenylthiourea;N-Phenyl-N'-methylthiourea; N1-Methyl-N2-phenylthiourea; NSC 3736 |
| CAS: | 2724-69-8 |
| Molecular Formula: | C8H10 N2 S |
| Molecular Weight: | 166.26 |
| InChI: | InChI=1/C8H10N2S/c1-9-8(11)10-7-5-3-2-4-6-7/h2-6H,1H3,(H2,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 113°C |
| Flash Point: | 103.4°C |
| Boiling Point: | 247.4°Cat760mmHg |
| Density: | 1.194g/cm3 |
| Refractive index: | 1.659 |
| Specification: |
N-Methyl-N'-phenyl thiourea (CAS NO.2724-69-8) is also called 1-Methyl-3-phenylthiocarbamide ; 1-Methyl-3-phenylthiourea ; 1-Phenyl-3-methylthiourea ; 3-12-00-00853 (Beilstein Handbook Reference) ; BRN 0638006 ; N-Methyl-N'-phenylthiourea ; NSC 3736 ; Thiourea, N-methyl-N'-phenyl- ; Urea, 1-methyl-3-phenyl-2-thio- . N-Methyl-N'-phenyl thiourea (CAS NO.2724-69-8) is lamellae. It can soluble in ethanol and ether and also can dissolve in water. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 103.4°C |
| Safety Data | |
 |
|
