| Identification |
| Name: | 3-Bromophenylhydrazine hydrochloride |
| Synonyms: | - |
| CAS: | 27246-81-7 |
| EINECS: | 248-362-0 |
| Molecular Formula: | C6H7BrN2?HCl |
| Molecular Weight: | 223.5 |
| InChI: | InChI=1/C6H7BrN2.ClH/c7-5-2-1-3-6(4-5)9-8;/h1-4,9H,8H2;1H |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1759 |
| Density: | g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.68 |
| Appearance: | similar to white powder |
| Packinggroup: | I; II; III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Usage: | A phenylhydrazone derivative with fungicidal activity. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
