| Identification | |
| Name: | 2H-Benzotriazole |
| Synonyms: | 2,1,3-Benzotriazole(4CI); 1,2,3-Triaza-2H-isoindene; 2H-1,2,3-Benzotriazole; Benzene, azimino-;Pseudoazimidobenzene |
| CAS: | 273-02-9 |
| Molecular Formula: | C6H5 N3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C6H5N3/c1-2-4-6-5(3-1)7-9-8-6/h1-4H,(H,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 98.5 deg C |
| Flash Point: | 133.9°C |
| Boiling Point: | 276.1°Cat760mmHg |
| Density: | 1.348g/cm3 |
| Solubility: | Sol in alcohol, benzene, toluene, chloroform and N,N-dimethylformamide Soluble in ethanol, benzene, and chloroform In water, 1.98X10+4 mg/l @ 25 deg C |
| Flash Point: | 133.9°C |
| Color: | NEEDLES FROM BENZENE White to light tan, crystalline powder. |
| Safety Data | |
 |
|
