| Identification | |
| Name: | 3-amino-1,2,4-benzotriazine-1,4-dioxide |
| Synonyms: | tirapazamine |
| CAS: | 27314-97-2 |
| Molecular Formula: | C7H6N4O2 |
| Molecular Weight: | 178.15 |
| InChI: | InChI=1/C7H6N4O2/c8-7-9-11(13)6-4-2-1-3-5(6)10(7)12/h1-4H,(H2,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 220ºC |
| Density: | 1.68 g/cm3 |
| Refractive index: | 1.777 |
| Appearance: | Orange-red crystalline powder |
| Specification: |
1,2,4-Benzotriazin-3-amine, 1,4-dioxide (CAS NO.27314-97-2) is also called as Tirapazamine ; Tirapazamine [USAN:INN] ; 3-Amino-1,2,4-benzotriazine 1,4-dioxide ; 3-Amino-1,2,4-benzotriazine-1,4-dioxide ; 4-26-00-01120 (Beilstein Handbook Reference) ; BRN 0179322 ; SR 4233 ; Tirapazamine ; UNII-1UD32YR59G ; WIN 59075 ; 1,2,4-Benzotriazine, 3-amino-, 1,4-dioxide . |
| Storage Temperature: | 2-8°C |
| Usage: |
1,2,4-Benzotriazin-3-amine, 1,4-dioxide (CAS NO.27314-97-2) can be used as a bioreductive anticancer agent and an antineoplastic. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
