Identification |
Name: | Ethanethioamide,2-(dimethylamino)-, hydrochloride (1:1) |
Synonyms: | Ethanethioamide,2-(dimethylamino)-, monohydrochloride (9CI);(Dimethylamino)thioacetamidehydrochloride; |
CAS: | 27366-72-9 |
Molecular Formula: | C4H10N2S.HCl |
Molecular Weight: | 154.66 |
InChI: | InChI=1/C4H10N2S/c1-6(2)3-4(5)7/h3H2,1-2H3,(H2,5,7) |
Molecular Structure: |
 |
Properties |
Flash Point: | 60.3°C |
Boiling Point: | 176°Cat760mmHg |
Density: | 1.069g/cm3 |
Refractive index: | 1.548 |
Specification: |
2-(Dimethylamino)thioacetamide hydrochloride , its cas register number is 27366-72-9. It also can be called 2-(Dimethylamino)ethanethioamide hydrochloride (1:1) ; and Ethanethioamide, 2-(dimethylamino)-, hydrochloride (1:1) .
|
Flash Point: | 60.3°C |
Safety Data |
|
 |