| Identification | |
| Name: | Ethanethioamide,2-(dimethylamino)-, hydrochloride (1:1) |
| Synonyms: | Ethanethioamide,2-(dimethylamino)-, monohydrochloride (9CI);(Dimethylamino)thioacetamidehydrochloride; |
| CAS: | 27366-72-9 |
| Molecular Formula: | C4H10N2S.HCl |
| Molecular Weight: | 154.66 |
| InChI: | InChI=1/C4H10N2S/c1-6(2)3-4(5)7/h3H2,1-2H3,(H2,5,7) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 60.3°C |
| Boiling Point: | 176°Cat760mmHg |
| Density: | 1.069g/cm3 |
| Refractive index: | 1.548 |
| Specification: |
2-(Dimethylamino)thioacetamide hydrochloride , its cas register number is 27366-72-9. It also can be called 2-(Dimethylamino)ethanethioamide hydrochloride (1:1) ; and Ethanethioamide, 2-(dimethylamino)-, hydrochloride (1:1) . |
| Flash Point: | 60.3°C |
| Safety Data | |
 |
|
