| Identification | |
| Name: | 3-Heptene,2,6-dimethyl- |
| Synonyms: | 2,6-Dimethyl-3-heptene |
| CAS: | 2738-18-3 |
| EINECS: | 220-362-5 |
| Molecular Formula: | C9H18 |
| Molecular Weight: | 126.23 |
| InChI: | InChI=1/C9H18/c1-8(2)6-5-7-9(3)4/h5-6,8-9H,7H2,1-4H3/b6-5+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 32019 |
| Flash Point: | 24.4°C |
| Boiling Point: | 135°Cat760mmHg |
| Density: | 0.736g/cm3 |
| Refractive index: | 1.423 |
| Specification: |
2,6-Dimethyl-3-heptene ,its cas register number is 2738-18-3. It also can be called 3-Heptene, 2,6-dimethyl- ; and 2,6-Dimethylhept-3-ene . |
| Packinggroup: | O52 |
| Flash Point: | 24.4°C |
| Safety Data | |
 |
|
