| Identification | |
| Name: | 1-Bis(4-fluorophenyl)methyl piperazine |
| Synonyms: | N-(4,4-Difluorobenzhydryl)piperazine; 1-[Bis(4-fluorophenyl)methyl]piperazine; 1-(4,4'-difluorobenzhydryl)piperazine; 1-(bis(4-fluorophenyl)methyl) piperazine; 4,4'-Difluorobenzhydrylpiperazine; Di(4-fluorophenyl)methyl piperazine; |
| CAS: | 27469-60-9 |
| EINECS: | 248-476-0 |
| Molecular Formula: | C17H18F2N2 |
| Molecular Weight: | 288.34 |
| InChI: | InChI=1/C17H18F2N2/c18-15-5-1-13(2-6-15)17(21-11-9-20-10-12-21)14-3-7-16(19)8-4-14/h1-8,17,20H,9-12H2 |
| Molecular Structure: | ![(C17H18F2N2) N-(4,4-Difluorobenzhydryl)piperazine; 1-[Bis(4-fluorophenyl)methyl]piperazine; 1-(4,4'-difluorobenzh...](https://img.guidechem.com/casimg/27469-60-9.gif) |
| Properties | |
| Transport: | UN 2811 |
| Flash Point: | 176 |
| Density: | 1.181 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | 345 mg/l |
| Appearance: | white to off-white powder |
| Specification: |
? 4,4'-Difluorobenzhydrylpiperazine , with CAS number of 27469-60-9, can be called 1-[Bis(4-fluorphenyl)methyl]piperazin ; 1-[Bis(4-fluorophenyl)methyl]piperazine ; piperazine, 1-[bis(4-fluorophenyl)methyl]- ; 1-(4,4'-Difluorobenzhydryl)piperazine 97% . It is a?white to yellow crystalline powder. |
| Packinggroup: | I; II; III |
| Flash Point: | 176 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
