| Identification |
| Name: | Cyclohexanol,4-amino-, trans- |
| Synonyms: | 4-trans-Hydroxycyclohexylamine;trans-1,4-Cyclohexanolamine;trans-1-Amino-4-cyclohexanol;trans-4-Amino-1-cyclohexanol;trans-4-Hydroxycyclohexylamine; |
| CAS: | 27489-62-9 |
| EINECS: | 248-492-8 |
| Molecular Formula: | C6H13NO |
| Molecular Weight: | 115.17 |
| InChI: | InChI=1/C6H13NO/c7-5-1-3-6(8)4-2-5/h5-6,8H,1-4,7H2/t5-,6+ |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.037g/cm3 |
| Stability: | No data. |
| Refractive index: | 1.502 |
| Solubility: | soluble in chloroform and other organic solvents |
| Appearance: | white to light yellow crystal powder |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
