Identification |
Name: | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-ethyl-1,3-bis(methoxymethyl)-5-phenyl- |
Synonyms: | Barbituricacid, 5-ethyl-1,3-bis(methoxymethyl)-5-phenyl- (8CI); 1,3-Bis(methoxymethyl)-5-ethyl-5-phenylbarbituricacid; 1,3-Bis(methoxymethyl)phenobarbital; Antilon; EX 12-095; Eterobarb;Eterobarbital; N,N'-Bis(methoxymethyl)phenobarbital;N,N'-Dimethoxymethylphenobarbital; RMI 16238 |
CAS: | 27511-99-5 |
Molecular Formula: | C16H20 N2 O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C16H20N2O5/c1-4-16(12-8-6-5-7-9-12)13(19)17(10-22-2)15(21)18(11-23-3)14(16)20/h5-9H,4,10-11H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 206.7°C |
Boiling Point: | 418.2°Cat760mmHg |
Density: | 1.203g/cm3 |
Refractive index: | 1.526 |
Flash Point: | 206.7°C |
Usage: | Controlled substance (depressant).
An alkoxymethyl derivative of Phenobarbital, reported to have little or no hypnotic activity. Anticonvulsant |
Safety Data |
|
 |