| Identification | |
| Name: | 1H-Benzotriazole |
| Synonyms: | 1,2,3-1H-Benzotriazole;1,2,3-Benzotriazole; 1,2,3-Triaza-1H-indene; 1,2,3-Triazaindene;1,2-Aminoazophenylene; 1H-1,2,3-Benzotriazole; 2,3-Diazaindole; Azimidobenzene;Aziminobenzene; BLS 1326; BT 120; BT 120 (lubricant additive); BTA; Benzeneazimide; Benzisotriazole; C.V.I. Liquid; CVI; Cobratec 35G; Cobratec 99; D32-108; Entek; HY 2; ISK 3; Irgastab I 489; Kemitec TT; M 318; NSC 3058; RusminR; Seetec BT; Seetec BT-R; Verzone Crystal |
| CAS: | 27556-51-0 |
| Molecular Formula: | C6H5N3 |
| Molecular Weight: | 119.127 |
| InChI: | InChI=1S/C6H5N3/c1-2-4-6-5(3-1)7-9-8-6/h1-4H,(H,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 98.5 deg C |
| Boiling Point: | 204 deg C @ 15 mm Hg; 159 deg C @ 2 mm Hg |
| Solubility: | Sol in alcohol, benzene, toluene, chloroform and N,N-dimethylformamide Soluble in ethanol, benzene, and chloroform In water, 1.98X10+4 mg/l @ 25 deg C |
| Color: | NEEDLES FROM BENZENE White to light tan, crystalline powder. |
| Safety Data | |
 |
|
