| Identification | |
| Name: | 2-Cyclopenten-1-one,3-methyl- |
| Synonyms: | 3-Methyl-2-cyclopenten-1-one;3-Methyl-2-cyclopentene-1-one;3-Methyl-2-cyclopentenone;Nussol;3-Methyl-2cyclopentene-1-one; |
| CAS: | 2758-18-1 |
| EINECS: | 220-421-5 |
| Molecular Formula: | C6H8O |
| Molecular Weight: | 96.13 |
| InChI: | InChI=1/C6H8O/c1-5-2-3-6(7)4-5/h4H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1224 |
| Density: | 0.98 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.487-1.49 |
| Water Solubility: | miscible |
| Solubility: | miscible in water |
| Appearance: | clear light yellow to yellow-brownish liquid |
| Specification: |
2-Cyclopenten-1-one,3-methyl- , with CAS number of 2758-18-1, can be called 1-Methyl-1-cyclopenten-3-one ; 3-methyl-2-cyclopenten-1-on ; 3-Methyl-cyclopent-2-enone ; 3-methylcyclopent-2-enone ; Methylcyclopentenone ; 3-Methyl-2-cyclopenten-1-one ; 3-Methyl-2-cyclopentene-1-one ; 3-Methyl-2-cyclopentenone . 2-Cyclopenten-1-one,3-methyl- (CAS NO.2758-18-1) is a clear light yellow to yellow-brownish liquid. |
| Packinggroup: | III |
| HS Code: | 29142900 |
| Safety Data | |
 |
|
