| Identification | |
| Name: | 4-(2,4-Dichlorophenoxy)butyric acid dimethylamine salt |
| Synonyms: | 4-(2,4-dichlorophenoxy)butyric acid, compound with dimethylamine (1:1);BUTOXONE 175;BUTOXONE 200;2,4-dichlorophenoxybutyric acid dimethylamine salt |
| CAS: | 2758-42-1 |
| EINECS: | 220-422-0 |
| Molecular Formula: | C10H10Cl2O3 . C2H6N |
| Molecular Weight: | 294.176 |
| InChI: | InChI=1/C10H10Cl2O3.C2H7N/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14;1-3-2/h3-4,6H,1-2,5H2,(H,13,14);3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2588 |
| Flash Point: | 202°C |
| Boiling Point: | 410.4°C at 760 mmHg |
| Specification: |
4-(2,4-Dichlorophenoxy)butyric acid dimethylamine salt , its CAS NO. is 2758-42-1, the synonyms are 2,4-DB dimethylamine salt ; 2,4-DB-Dimethylammonium ; CCRIS 8800 ; Caswell No. 316C ; EINECS 220-422-0 ; EPA Pesticide Chemical Code 030819 ; 4-(2,4-Dichlorophenoxy)butyric acid, compound with dimethylamine (1:1) ; Butanoic acid, 4-(2,4-dichlorophenoxy)-, compd. with N-methylmethanamine (1:1) ; Butyric acid, 4-(2,4-dichlorophenoxy)-, dimethylamine salt ; Dimethylamine 4-(2,4-dichlorophenoxy)butyrate . |
| Packinggroup: | III |
| Flash Point: | 202°C |
| Safety Data | |
 |
|
