| Identification | |
| Name: | 3,4-Pyrrolidinediol,hydrochloride (1:1), (3S,4S)- |
| Synonyms: | 3,4-Pyrrolidinediol,hydrochloride, (3S,4S)- (9CI);(3S,4S)-Pyrrolidine-3,4-diol hydrochloride; |
| CAS: | 276862-76-1 |
| Molecular Formula: | C4H10ClNO2 |
| Molecular Weight: | 139.58 |
| InChI: | InChI=1/C4H9NO2.ClH/c6-3-1-5-2-4(3)7;/h3-7H,1-2H2;1H/t3-,4-;/m0./s1 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
The (3S,4S)-Pyrrolidine-3,4-diol hydrochloride, with the CAS registry number 276862-76-1, is also known as (3S,4S)-3,4-Dihydroxypyrrolidine hydrochloride. Molecular formula of (3S,4S)-Pyrrolidine-3,4-diol hydrochloride is C4H10ClNO2 and its molecular weight is 139.58. What's more, its systematic name is called 3,4-Pyrrolidinediol, (3S,4S)-, hydrochloride (1:1). You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
